C15H12O4 — CID 163920583
6-hydroxy-15-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),5,9,13(16)-tetraene-3,4-dione (PubChem CID 163920583) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 6-hydroxy-15-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),5,9,13(16)-tetraene-3,4-dione.
| Compound Name | 6-hydroxy-15-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),5,9,13(16)-tetraene-3,4-dione |
|---|---|
| PubChem CID | 163920583 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 6-hydroxy-15-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),5,9,13(16)-tetraene-3,4-dione |
| SMILES | O=C1C=C(O)C2=C(C1=O)C1OCC3=C1C(=CCC3)C2 |
| InChI | InChI=1S/C15H12O4/c16-10-5-11(17)14(18)13-9(10)4-7-2-1-3-8-6-19-15(13)12(7)8/h2,5,15-16H,1,3-4,6H2 |
| InChIKey | XRRGSBXRTOXNGF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|