C14H16N2O — CID 163921713
(4-amino-3-methylcyclohexa-1,5-dien-1-yl)-(4-aminophenyl)methanone (PubChem CID 163921713) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (4-amino-3-methylcyclohexa-1,5-dien-1-yl)-(4-aminophenyl)methanone.
| Compound Name | (4-amino-3-methylcyclohexa-1,5-dien-1-yl)-(4-aminophenyl)methanone |
|---|---|
| PubChem CID | 163921713 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (4-amino-3-methylcyclohexa-1,5-dien-1-yl)-(4-aminophenyl)methanone |
| SMILES | CC1C=C(C(=O)c2ccc(N)cc2)C=CC1N |
| InChI | InChI=1S/C14H16N2O/c1-9-8-11(4-7-13(9)16)14(17)10-2-5-12(15)6-3-10/h2-9,13H,15-16H2,1H3 |
| InChIKey | RAYJJGXHVVLDQG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|