C10H13N3O2S — CID 163921898
N-[4-(2,3-dihydro-1H-pyrazol-5-yl)phenyl]methanesulfonamide (PubChem CID 163921898) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1H-pyrazol-5-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(2,3-dihydro-1H-pyrazol-5-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 163921898 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-[4-(2,3-dihydro-1H-pyrazol-5-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C2=CCNN2)cc1 |
| InChI | InChI=1S/C10H13N3O2S/c1-16(14,15)13-9-4-2-8(3-5-9)10-6-7-11-12-10/h2-6,11-13H,7H2,1H3 |
| InChIKey | RBCLLRRQJOVLMT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |