About 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane
2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane (PubChem CID 163922367) has the molecular formula C15H24ClN3
and a molecular weight of 281.83 g/mol. Its IUPAC name is 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane.
Molecular Properties
| Compound Name | 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane |
| PubChem CID | 163922367 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane |
| SMILES | ClC1NC(C2=CCCCC2)NC(C2CC=CCC2)N1 |
| InChI | InChI=1S/C15H24ClN3/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1,3,9,11,13-15,17-19H,2,4-8,10H2 |
| InChIKey | RBMXCEBQELILSV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane?
The IUPAC name of 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane (CID 163922367) is 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane.
What is the SMILES notation for 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane?
The canonical SMILES for 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane is ClC1NC(C2=CCCCC2)NC(C2CC=CCC2)N1.
What is the InChIKey of 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane?
The InChIKey is RBMXCEBQELILSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClN3/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1,3,9,11,13-15,17-19H,2,4-8,10H2.
What are the key properties of 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane?
2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane has a molecular weight of 281.83 g/mol, XLogP of 2.80, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(cyclohexen-1-yl)-6-cyclohex-3-en-1-yl-1,3,5-triazinane is sourced from PubChem (CID 163922367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).