C9H13I — CID 163922499
(6R)-2-iodo-1,4,6-trimethylcyclohexa-1,3-diene (PubChem CID 163922499) has the molecular formula C9H13I and a molecular weight of 248.11 g/mol. Its IUPAC name is (6R)-2-iodo-1,4,6-trimethylcyclohexa-1,3-diene.
| Compound Name | (6R)-2-iodo-1,4,6-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163922499 |
| Molecular Formula | C9H13I |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | (6R)-2-iodo-1,4,6-trimethylcyclohexa-1,3-diene |
| SMILES | CC1=CC(I)=C(C)[C@H](C)C1 |
| InChI | InChI=1S/C9H13I/c1-6-4-7(2)8(3)9(10)5-6/h5,7H,4H2,1-3H3/t7-/m1/s1 |
| InChIKey | RBPVDYZZFUBFSB-SSDOTTSWSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|