C33H29Cl2NOS — CID 163922880
4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-[4-[(E)-3-oxobut-1-enyl]phenyl]but-1-enyl]-1,2,3,3a,10,10a-hexahydrobenzo[f]azulene-5-carbonitrile (PubChem CID 163922880) has the molecular formula C33H29Cl2NOS and a molecular weight of 558.57 g/mol. Its IUPAC name is 4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-[4-[(E)-3-oxobut-1-enyl]phenyl]but-1-enyl]-1,2,3,3a,10,10a-hexahydrobenzo[f]azulene-5-carbonitrile.
| Compound Name | 4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-[4-[(E)-3-oxobut-1-enyl]phenyl]but-1-enyl]-1,2,3,3a,10,10a-hexahydrobenzo[f]azulene-5-carbonitrile |
|---|---|
| PubChem CID | 163922880 |
| Molecular Formula | C33H29Cl2NOS |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-[4-[(E)-3-oxobut-1-enyl]phenyl]but-1-enyl]-1,2,3,3a,10,10a-hexahydrobenzo[f]azulene-5-carbonitrile |
| SMILES | CC/C(=C(\C1=C(C#N)c2ccccc2CC2CCCC12)c1ccc(/C=C/C(C)=O)cc1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C33H29Cl2NOS/c1-3-25(28-18-30(34)38-33(28)35)31(22-15-13-21(14-16-22)12-11-20(2)37)32-27-10-6-8-24(27)17-23-7-4-5-9-26(23)29(32)19-36/h4-5,7,9,11-16,18,24,27H,3,6,8,10,17H2,1-2H3/b12-11+,31-25+ |
| InChIKey | RBYSCTAIWPHLRR-LXVDMTOCSA-N |
| XLogP | 9.93 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|