C11H17N3O — CID 163923579
(Z)-4-methoxy-4-phenylbut-3-ene-1,1,1-triamine (PubChem CID 163923579) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (Z)-4-methoxy-4-phenylbut-3-ene-1,1,1-triamine.
| Compound Name | (Z)-4-methoxy-4-phenylbut-3-ene-1,1,1-triamine |
|---|---|
| PubChem CID | 163923579 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (Z)-4-methoxy-4-phenylbut-3-ene-1,1,1-triamine |
| SMILES | CO/C(=C\CC(N)(N)N)c1ccccc1 |
| InChI | InChI=1S/C11H17N3O/c1-15-10(7-8-11(12,13)14)9-5-3-2-4-6-9/h2-7H,8,12-14H2,1H3/b10-7- |
| InChIKey | RCNHHLZLYLBQPJ-YFHOEESVSA-N |
| XLogP | 0.59 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|