About 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine
5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine (PubChem CID 163923916) has the molecular formula C10H18N3+
and a molecular weight of 180.28 g/mol. Its IUPAC name is 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine.
Molecular Properties
| Compound Name | 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine |
| PubChem CID | 163923916 |
| Molecular Formula | C10H18N3+ |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine |
| SMILES | NC1=CC(C2CCCCC2)=CN[NH2+]1 |
| InChI | InChI=1S/C10H17N3/c11-10-6-9(7-12-13-10)8-4-2-1-3-5-8/h6-8,12-13H,1-5,11H2/p+1 |
| InChIKey | RCUWQSRFVGGTDA-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine?
The IUPAC name of 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine (CID 163923916) is 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine.
What is the SMILES notation for 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine?
The canonical SMILES for 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine is NC1=CC(C2CCCCC2)=CN[NH2+]1.
What is the InChIKey of 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine?
The InChIKey is RCUWQSRFVGGTDA-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H17N3/c11-10-6-9(7-12-13-10)8-4-2-1-3-5-8/h6-8,12-13H,1-5,11H2/p+1.
What are the key properties of 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine?
5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine has a molecular weight of 180.28 g/mol, XLogP of 0.33, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1,2-dihydropyridazin-2-ium-3-amine is sourced from PubChem (CID 163923916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).