About N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide
N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide (PubChem CID 163924311) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide.
Molecular Properties
| Compound Name | N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide |
| PubChem CID | 163924311 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide |
| SMILES | CCCc1nc(N=C(C)N)sc1CCC |
| InChI | InChI=1S/C11H19N3S/c1-4-6-9-10(7-5-2)15-11(14-9)13-8(3)12/h4-7H2,1-3H3,(H2,12,13,14) |
| InChIKey | RDDOOJZPECJWMF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide?
The IUPAC name of N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide (CID 163924311) is N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide.
What is the SMILES notation for N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide?
The canonical SMILES for N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide is CCCc1nc(N=C(C)N)sc1CCC.
What is the InChIKey of N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide?
The InChIKey is RDDOOJZPECJWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c1-4-6-9-10(7-5-2)15-11(14-9)13-8(3)12/h4-7H2,1-3H3,(H2,12,13,14).
What are the key properties of N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide?
N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide has a molecular weight of 225.36 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,5-dipropyl-1,3-thiazol-2-yl)ethanimidamide is sourced from PubChem (CID 163924311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).