C13H18 — CID 163924796
(1R,2R)-1,2,6,7-tetramethyl-2,3-dihydro-1H-indene (PubChem CID 163924796) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (1R,2R)-1,2,6,7-tetramethyl-2,3-dihydro-1H-indene.
| Compound Name | (1R,2R)-1,2,6,7-tetramethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 163924796 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (1R,2R)-1,2,6,7-tetramethyl-2,3-dihydro-1H-indene |
| SMILES | Cc1ccc2c(c1C)[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C13H18/c1-8-5-6-12-7-9(2)11(4)13(12)10(8)3/h5-6,9,11H,7H2,1-4H3/t9-,11-/m1/s1 |
| InChIKey | WZHXLMDARFIONW-MWLCHTKSSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |