About 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid
2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid (PubChem CID 163925124) has the molecular formula C12H20O5S2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid |
| PubChem CID | 163925124 |
| Molecular Formula | C12H20O5S2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid |
| SMILES | CS(C)(CC(=O)OCCS(=O)(=O)O)C1=CC=CCC1 |
| InChI | InChI=1S/C12H20O5S2/c1-18(2,11-6-4-3-5-7-11)10-12(13)17-8-9-19(14,15)16/h3-4,6H,5,7-10H2,1-2H3,(H,14,15,16) |
| InChIKey | RDUDSYPOHRDGTE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid?
The IUPAC name of 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid (CID 163925124) is 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid.
What is the SMILES notation for 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid?
The canonical SMILES for 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid is CS(C)(CC(=O)OCCS(=O)(=O)O)C1=CC=CCC1.
What is the InChIKey of 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid?
The InChIKey is RDUDSYPOHRDGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5S2/c1-18(2,11-6-4-3-5-7-11)10-12(13)17-8-9-19(14,15)16/h3-4,6H,5,7-10H2,1-2H3,(H,14,15,16).
What are the key properties of 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid?
2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid has a molecular weight of 308.42 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[cyclohexa-1,3-dien-1-yl(dimethyl)-λ4-sulfanyl]acetyl]oxyethanesulfonic acid is sourced from PubChem (CID 163925124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).