C17H26O4 — CID 163925443
[4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethyl-2-oxocyclohexyl] acetate (PubChem CID 163925443) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethyl-2-oxocyclohexyl] acetate.
| Compound Name | [4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethyl-2-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 163925443 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethyl-2-oxocyclohexyl] acetate |
| SMILES | C=CC(C)(O)/C=C/C1C(C)C(=O)C(OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C17H26O4/c1-7-17(6,20)9-8-13-11(2)15(19)14(21-12(3)18)10-16(13,4)5/h7-9,11,13-14,20H,1,10H2,2-6H3/b9-8+ |
| InChIKey | REBXMYPECSXDHA-CMDGGOBGSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|