C21H15F2N3O5S — CID 163926327
methyl 4-[4-(1,1-difluoroprop-2-enylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate (PubChem CID 163926327) has the molecular formula C21H15F2N3O5S and a molecular weight of 459.43 g/mol. Its IUPAC name is methyl 4-[4-(1,1-difluoroprop-2-enylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate.
| Compound Name | methyl 4-[4-(1,1-difluoroprop-2-enylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate |
|---|---|
| PubChem CID | 163926327 |
| Molecular Formula | C21H15F2N3O5S |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | methyl 4-[4-(1,1-difluoroprop-2-enylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate |
| SMILES | C=CC(F)(F)S(=O)(=O)Oc1cc2c(cn1)[nH]c1nccc(-c3ccc(C(=O)OC)cc3)c12 |
| InChI | InChI=1S/C21H15F2N3O5S/c1-3-21(22,23)32(28,29)31-17-10-15-16(11-25-17)26-19-18(15)14(8-9-24-19)12-4-6-13(7-5-12)20(27)30-2/h3-11H,1H2,2H3,(H,24,26) |
| InChIKey | REUDRQDFMYRAPM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|