C26H28N2O4S — CID 163927436
1-[(2S)-4-(cyclobutanecarbonyl)-6-(4-cyclopropylsulfonylphenyl)-2-ethenyl-2,3-dihydroquinoxalin-1-yl]ethanone (PubChem CID 163927436) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-[(2S)-4-(cyclobutanecarbonyl)-6-(4-cyclopropylsulfonylphenyl)-2-ethenyl-2,3-dihydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(cyclobutanecarbonyl)-6-(4-cyclopropylsulfonylphenyl)-2-ethenyl-2,3-dihydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 163927436 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-[(2S)-4-(cyclobutanecarbonyl)-6-(4-cyclopropylsulfonylphenyl)-2-ethenyl-2,3-dihydroquinoxalin-1-yl]ethanone |
| SMILES | C=C[C@H]1CN(C(=O)C2CCC2)c2cc(-c3ccc(S(=O)(=O)C4CC4)cc3)ccc2N1C(C)=O |
| InChI | InChI=1S/C26H28N2O4S/c1-3-21-16-27(26(30)19-5-4-6-19)25-15-20(9-14-24(25)28(21)17(2)29)18-7-10-22(11-8-18)33(31,32)23-12-13-23/h3,7-11,14-15,19,21,23H,1,4-6,12-13,16H2,2H3/t21-/m0/s1 |
| InChIKey | RFSQLQRLUZELPJ-NRFANRHFSA-N |
| XLogP | 4.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|