About (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile
(3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile (PubChem CID 163927656) has the molecular formula C12H14F2N2
and a molecular weight of 224.25 g/mol. Its IUPAC name is (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 163927656 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile |
| SMILES | CC1C(F)=CC(C#N)=C[C@H]1C1C[C@H](F)CN1 |
| InChI | InChI=1S/C12H14F2N2/c1-7-10(12-4-9(13)6-16-12)2-8(5-15)3-11(7)14/h2-3,7,9-10,12,16H,4,6H2,1H3/t7?,9-,10+,12?/m0/s1 |
| InChIKey | RFXGICZVBJFPOF-XAKWWSDWSA-N |
| XLogP | 2.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile (CID 163927656) is (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile is CC1C(F)=CC(C#N)=C[C@H]1C1C[C@H](F)CN1.
What is the InChIKey of (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is RFXGICZVBJFPOF-XAKWWSDWSA-N. The full InChI is InChI=1S/C12H14F2N2/c1-7-10(12-4-9(13)6-16-12)2-8(5-15)3-11(7)14/h2-3,7,9-10,12,16H,4,6H2,1H3/t7?,9-,10+,12?/m0/s1.
What are the key properties of (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile?
(3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 224.25 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-fluoro-3-[(4S)-4-fluoropyrrolidin-2-yl]-4-methylcyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 163927656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).