C19H19ClFN3O2S — CID 163927954
ethyl 3-(2-chloro-3-fluorocyclohexa-1,5-dien-1-yl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 163927954) has the molecular formula C19H19ClFN3O2S and a molecular weight of 407.90 g/mol. Its IUPAC name is ethyl 3-(2-chloro-3-fluorocyclohexa-1,5-dien-1-yl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl 3-(2-chloro-3-fluorocyclohexa-1,5-dien-1-yl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 163927954 |
| Molecular Formula | C19H19ClFN3O2S |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 3-(2-chloro-3-fluorocyclohexa-1,5-dien-1-yl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2CCCN2C(c2nccs2)=NC1C1=C(Cl)C(F)CC=C1 |
| InChI | InChI=1S/C19H19ClFN3O2S/c1-2-26-19(25)14-13-7-4-9-24(13)17(18-22-8-10-27-18)23-16(14)11-5-3-6-12(21)15(11)20/h3,5,8,10,12,16H,2,4,6-7,9H2,1H3 |
| InChIKey | RGDLMDCIFHYYKU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |