About 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene
5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene (PubChem CID 163928409) has the molecular formula C9H12BrF3
and a molecular weight of 257.09 g/mol. Its IUPAC name is 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene.
Molecular Properties
| Compound Name | 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene |
| PubChem CID | 163928409 |
| Molecular Formula | C9H12BrF3 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene |
| SMILES | CC1C(C(F)(F)F)C=CCC1(C)Br |
| InChI | InChI=1S/C9H12BrF3/c1-6-7(9(11,12)13)4-3-5-8(6,2)10/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | RGMYKNUNQWXXQQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene?
The IUPAC name of 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene (CID 163928409) is 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene.
What is the SMILES notation for 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene?
The canonical SMILES for 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene is CC1C(C(F)(F)F)C=CCC1(C)Br.
What is the InChIKey of 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene?
The InChIKey is RGMYKNUNQWXXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrF3/c1-6-7(9(11,12)13)4-3-5-8(6,2)10/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene?
5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene has a molecular weight of 257.09 g/mol, XLogP of 3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,5-dimethyl-3-(trifluoromethyl)cyclohexene is sourced from PubChem (CID 163928409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).