C9H12FNO — CID 163929275
4-[(1Z)-1-fluorobuta-1,3-dien-2-yl]oxy-1,2,3,6-tetrahydropyridine (PubChem CID 163929275) has the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. Its IUPAC name is 4-[(1Z)-1-fluorobuta-1,3-dien-2-yl]oxy-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(1Z)-1-fluorobuta-1,3-dien-2-yl]oxy-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 163929275 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-[(1Z)-1-fluorobuta-1,3-dien-2-yl]oxy-1,2,3,6-tetrahydropyridine |
| SMILES | C=C/C(=C/F)OC1=CCNCC1 |
| InChI | InChI=1S/C9H12FNO/c1-2-8(7-10)12-9-3-5-11-6-4-9/h2-3,7,11H,1,4-6H2/b8-7- |
| InChIKey | RHHNOUUVSDJFCS-FPLPWBNLSA-N |
| XLogP | 1.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|