About (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide
(6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide (PubChem CID 163930461) has the molecular formula C18H31FN2O
and a molecular weight of 310.46 g/mol. Its IUPAC name is (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide.
Molecular Properties
| Compound Name | (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide |
| PubChem CID | 163930461 |
| Molecular Formula | C18H31FN2O |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide |
| SMILES | C=CC(F)C/C=C\C(=C)CCCC(=O)NCCN(C)CCC |
| InChI | InChI=1S/C18H31FN2O/c1-5-14-21(4)15-13-20-18(22)12-8-10-16(3)9-7-11-17(19)6-2/h6-7,9,17H,2-3,5,8,10-15H2,1,4H3,(H,20,22)/b9-7- |
| InChIKey | RIGFJMVSRHRARC-CLFYSBASSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide?
The IUPAC name of (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide (CID 163930461) is (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide.
What is the SMILES notation for (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide?
The canonical SMILES for (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide is C=CC(F)C/C=C\C(=C)CCCC(=O)NCCN(C)CCC.
What is the InChIKey of (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide?
The InChIKey is RIGFJMVSRHRARC-CLFYSBASSA-N. The full InChI is InChI=1S/C18H31FN2O/c1-5-14-21(4)15-13-20-18(22)12-8-10-16(3)9-7-11-17(19)6-2/h6-7,9,17H,2-3,5,8,10-15H2,1,4H3,(H,20,22)/b9-7-.
What are the key properties of (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide?
(6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide has a molecular weight of 310.46 g/mol, XLogP of 3.64, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-9-fluoro-5-methylidene-N-[2-[methyl(propyl)amino]ethyl]undeca-6,10-dienamide is sourced from PubChem (CID 163930461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).