C9H15F3NO3S- — CID 163930822
N-(2-cyclohexylethyl)-1,1,1-trifluoro-N-oxidomethanesulfonamide (PubChem CID 163930822) has the molecular formula C9H15F3NO3S- and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-1,1,1-trifluoro-N-oxidomethanesulfonamide.
| Compound Name | N-(2-cyclohexylethyl)-1,1,1-trifluoro-N-oxidomethanesulfonamide |
|---|---|
| PubChem CID | 163930822 |
| Molecular Formula | C9H15F3NO3S- |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-(2-cyclohexylethyl)-1,1,1-trifluoro-N-oxidomethanesulfonamide |
| SMILES | O=S(=O)(N([O-])CCC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3NO3S/c10-9(11,12)17(15,16)13(14)7-6-8-4-2-1-3-5-8/h8H,1-7H2/q-1 |
| InChIKey | FAXGMMOAUAUQAY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|