About N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine
N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine (PubChem CID 163931201) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine.
Molecular Properties
| Compound Name | N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine |
| PubChem CID | 163931201 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine |
| SMILES | CNCNC1CC(C)C=CC1CC(C)(C)NC |
| InChI | InChI=1S/C14H29N3/c1-11-6-7-12(9-14(2,3)16-5)13(8-11)17-10-15-4/h6-7,11-13,15-17H,8-10H2,1-5H3 |
| InChIKey | RIUXHYPFHFLJMN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine?
The IUPAC name of N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine (CID 163931201) is N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine.
What is the SMILES notation for N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine?
The canonical SMILES for N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine is CNCNC1CC(C)C=CC1CC(C)(C)NC.
What is the InChIKey of N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine?
The InChIKey is RIUXHYPFHFLJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3/c1-11-6-7-12(9-14(2,3)16-5)13(8-11)17-10-15-4/h6-7,11-13,15-17H,8-10H2,1-5H3.
What are the key properties of N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine?
N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine has a molecular weight of 239.41 g/mol, XLogP of 1.72, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[5-methyl-2-[2-methyl-2-(methylamino)propyl]cyclohex-3-en-1-yl]methanediamine is sourced from PubChem (CID 163931201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).