About 1-amino-12-methoxytridecane-3,6,9-trione
1-amino-12-methoxytridecane-3,6,9-trione (PubChem CID 163931257) has the molecular formula C14H25NO4
and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-amino-12-methoxytridecane-3,6,9-trione.
Molecular Properties
| Compound Name | 1-amino-12-methoxytridecane-3,6,9-trione |
| PubChem CID | 163931257 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1-amino-12-methoxytridecane-3,6,9-trione |
| SMILES | COC(C)CCC(=O)CCC(=O)CCC(=O)CCN |
| InChI | InChI=1S/C14H25NO4/c1-11(19-2)3-4-12(16)5-6-13(17)7-8-14(18)9-10-15/h11H,3-10,15H2,1-2H3 |
| InChIKey | RIWBLEJTAXCQES-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-12-methoxytridecane-3,6,9-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-12-methoxytridecane-3,6,9-trione?
The IUPAC name of 1-amino-12-methoxytridecane-3,6,9-trione (CID 163931257) is 1-amino-12-methoxytridecane-3,6,9-trione.
What is the SMILES notation for 1-amino-12-methoxytridecane-3,6,9-trione?
The canonical SMILES for 1-amino-12-methoxytridecane-3,6,9-trione is COC(C)CCC(=O)CCC(=O)CCC(=O)CCN.
What is the InChIKey of 1-amino-12-methoxytridecane-3,6,9-trione?
The InChIKey is RIWBLEJTAXCQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO4/c1-11(19-2)3-4-12(16)5-6-13(17)7-8-14(18)9-10-15/h11H,3-10,15H2,1-2H3.
What are the key properties of 1-amino-12-methoxytridecane-3,6,9-trione?
1-amino-12-methoxytridecane-3,6,9-trione has a molecular weight of 271.36 g/mol, XLogP of 1.42, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-12-methoxytridecane-3,6,9-trione is sourced from PubChem (CID 163931257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).