C17H16F3IN4O — CID 163931486
4-[ethyl-[5-methyl-3-(trifluoromethyl)-1,4-dihydropyrazole-5-carbonyl]-λ3-iodanyl]-6-methylbenzene-1,3-dicarbonitrile (PubChem CID 163931486) has the molecular formula C17H16F3IN4O and a molecular weight of 476.24 g/mol. Its IUPAC name is 4-[ethyl-[5-methyl-3-(trifluoromethyl)-1,4-dihydropyrazole-5-carbonyl]-λ3-iodanyl]-6-methylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-[ethyl-[5-methyl-3-(trifluoromethyl)-1,4-dihydropyrazole-5-carbonyl]-λ3-iodanyl]-6-methylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 163931486 |
| Molecular Formula | C17H16F3IN4O |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 4-[ethyl-[5-methyl-3-(trifluoromethyl)-1,4-dihydropyrazole-5-carbonyl]-λ3-iodanyl]-6-methylbenzene-1,3-dicarbonitrile |
| SMILES | CCI(C(=O)C1(C)CC(C(F)(F)F)=NN1)c1cc(C)c(C#N)cc1C#N |
| InChI | InChI=1S/C17H16F3IN4O/c1-4-21(13-5-10(2)11(8-22)6-12(13)9-23)15(26)16(3)7-14(24-25-16)17(18,19)20/h5-6,25H,4,7H2,1-3H3 |
| InChIKey | RJAYBYCFZXVQOM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|