C16H12O4 — CID 163931596
5,8-dihydroxytetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene-3,10-dione (PubChem CID 163931596) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 5,8-dihydroxytetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene-3,10-dione.
| Compound Name | 5,8-dihydroxytetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene-3,10-dione |
|---|---|
| PubChem CID | 163931596 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5,8-dihydroxytetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene-3,10-dione |
| SMILES | O=C1C2=C(C(=O)c3c(O)ccc(O)c31)C1C=CC2CC1 |
| InChI | InChI=1S/C16H12O4/c17-9-5-6-10(18)14-13(9)15(19)11-7-1-2-8(4-3-7)12(11)16(14)20/h1-2,5-8,17-18H,3-4H2 |
| InChIKey | QNPKPXSHMWGHBB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|