C25H37N3 — CID 163932036
2-cyclohex-2-en-1-yl-10-cyclohexyl-3a,4,5,5a,6,7,8,9,10a,10b-decahydro-3H-imidazo[4,5-a]carbazole (PubChem CID 163932036) has the molecular formula C25H37N3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-10-cyclohexyl-3a,4,5,5a,6,7,8,9,10a,10b-decahydro-3H-imidazo[4,5-a]carbazole.
| Compound Name | 2-cyclohex-2-en-1-yl-10-cyclohexyl-3a,4,5,5a,6,7,8,9,10a,10b-decahydro-3H-imidazo[4,5-a]carbazole |
|---|---|
| PubChem CID | 163932036 |
| Molecular Formula | C25H37N3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-10-cyclohexyl-3a,4,5,5a,6,7,8,9,10a,10b-decahydro-3H-imidazo[4,5-a]carbazole |
| SMILES | C1=CC(C2=NC3C(CCC4C5=C(CCCC5)N(C5CCCCC5)C43)N2)CCC1 |
| InChI | InChI=1S/C25H37N3/c1-3-9-17(10-4-1)25-26-21-16-15-20-19-13-7-8-14-22(19)28(24(20)23(21)27-25)18-11-5-2-6-12-18/h3,9,17-18,20-21,23-24H,1-2,4-8,10-16H2,(H,26,27) |
| InChIKey | RJMLNVPCIRZNBP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|