C13H12O7 — CID 163932450
2-[(E,4E)-2-methyl-4-(4-methylidene-2,5-dioxooxolan-3-ylidene)but-2-enoyl]oxypropanoic acid (PubChem CID 163932450) has the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-[(E,4E)-2-methyl-4-(4-methylidene-2,5-dioxooxolan-3-ylidene)but-2-enoyl]oxypropanoic acid.
| Compound Name | 2-[(E,4E)-2-methyl-4-(4-methylidene-2,5-dioxooxolan-3-ylidene)but-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 163932450 |
| Molecular Formula | C13H12O7 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[(E,4E)-2-methyl-4-(4-methylidene-2,5-dioxooxolan-3-ylidene)but-2-enoyl]oxypropanoic acid |
| SMILES | C=C1C(=O)OC(=O)/C1=C/C=C(\C)C(=O)OC(C)C(=O)O |
| InChI | InChI=1S/C13H12O7/c1-6(11(16)19-8(3)10(14)15)4-5-9-7(2)12(17)20-13(9)18/h4-5,8H,2H2,1,3H3,(H,14,15)/b6-4+,9-5+ |
| InChIKey | RJVNYHVIJASYBE-REZHQCRGSA-N |
| XLogP | 0.51 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|