About 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine
3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine (PubChem CID 163932926) has the molecular formula C14H28F2N2O
and a molecular weight of 278.39 g/mol. Its IUPAC name is 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine |
| PubChem CID | 163932926 |
| Molecular Formula | C14H28F2N2O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCC(F)(F)C1.CC(C)N1CCOCC1 |
| InChI | InChI=1S/C7H13F2N.C7H15NO/c1-6(2)10-4-3-7(8,9)5-10;1-7(2)8-3-5-9-6-4-8/h6H,3-5H2,1-2H3;7H,3-6H2,1-2H3 |
| InChIKey | RKFVNKBWIUEUDX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine?
The IUPAC name of 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine (CID 163932926) is 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine.
What is the SMILES notation for 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine?
The canonical SMILES for 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine is CC(C)N1CCC(F)(F)C1.CC(C)N1CCOCC1.
What is the InChIKey of 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine?
The InChIKey is RKFVNKBWIUEUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N.C7H15NO/c1-6(2)10-4-3-7(8,9)5-10;1-7(2)8-3-5-9-6-4-8/h6H,3-5H2,1-2H3;7H,3-6H2,1-2H3.
What are the key properties of 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine?
3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine has a molecular weight of 278.39 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-propan-2-ylpyrrolidine;4-propan-2-ylmorpholine is sourced from PubChem (CID 163932926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).