C12H16N2 — CID 163933094
1,1-dideuterio-N,N-dimethyl-2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)ethanamine (PubChem CID 163933094) has the molecular formula C12H16N2 and a molecular weight of 195.32 g/mol. Its IUPAC name is 1,1-dideuterio-N,N-dimethyl-2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)ethanamine.
| Compound Name | 1,1-dideuterio-N,N-dimethyl-2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 163933094 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 195.32 g/mol |
| Exact Mass | 195.18 |
| IUPAC Name | 1,1-dideuterio-N,N-dimethyl-2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)ethanamine |
| SMILES | [2H]c1[nH]c2c([2H])c([2H])c([2H])c([2H])c2c1CC([2H])([2H])N(C)C |
| InChI | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3/i3D,4D,5D,6D,8D2,9D |
| InChIKey | DMULVCHRPCFFGV-SKTQUXPZSA-N |
| XLogP | 2.27 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |