About 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate
4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate (PubChem CID 163933560) has the molecular formula C12H21IO4
and a molecular weight of 356.20 g/mol. Its IUPAC name is 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate |
| PubChem CID | 163933560 |
| Molecular Formula | C12H21IO4 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)OCCCCO[I+][O-])CC1 |
| InChI | InChI=1S/C12H21IO4/c1-10-4-6-11(7-5-10)12(14)16-8-2-3-9-17-13-15/h10-11H,2-9H2,1H3 |
| InChIKey | RKTUOTSKGCUOJU-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate?
The IUPAC name of 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate (CID 163933560) is 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate?
The canonical SMILES for 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate is CC1CCC(C(=O)OCCCCO[I+][O-])CC1.
What is the InChIKey of 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate?
The InChIKey is RKTUOTSKGCUOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21IO4/c1-10-4-6-11(7-5-10)12(14)16-8-2-3-9-17-13-15/h10-11H,2-9H2,1H3.
What are the key properties of 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate?
4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate has a molecular weight of 356.20 g/mol, XLogP of -1.57, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodosyloxybutyl 4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 163933560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).