C52H52N4O2Si — CID 163933615
butyl-[3-[4-[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]-4,5-diphenylimidazol-2-yl]phenoxy]propyl]-dimethylsilane (PubChem CID 163933615) has the molecular formula C52H52N4O2Si and a molecular weight of 793.10 g/mol. Its IUPAC name is butyl-[3-[4-[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]-4,5-diphenylimidazol-2-yl]phenoxy]propyl]-dimethylsilane.
| Compound Name | butyl-[3-[4-[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]-4,5-diphenylimidazol-2-yl]phenoxy]propyl]-dimethylsilane |
|---|---|
| PubChem CID | 163933615 |
| Molecular Formula | C52H52N4O2Si |
| Molecular Weight | 793.10 g/mol |
| Exact Mass | 792.39 |
| IUPAC Name | butyl-[3-[4-[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]-4,5-diphenylimidazol-2-yl]phenoxy]propyl]-dimethylsilane |
| SMILES | CCCC[Si](C)(C)CCCOc1ccc(C2(n3c(-c4ccc(OC)cc4)nc(-c4ccccc4)c3-c3ccccc3)N=C(c3ccccc3)C(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C52H52N4O2Si/c1-5-6-37-59(3,4)38-19-36-58-46-34-30-44(31-35-46)52(54-47(39-20-11-7-12-21-39)48(55-52)40-22-13-8-14-23-40)56-50(42-26-17-10-18-27-42)49(41-24-15-9-16-25-41)53-51(56)43-28-32-45(57-2)33-29-43/h7-18,20-35H,5-6,19,36-38H2,1-4H3 |
| InChIKey | RKVAQODKCWHIEP-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.10 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|