About (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine
(2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine (PubChem CID 163933764) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine |
| PubChem CID | 163933764 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine |
| SMILES | CC/C=C(\N=C\[C@@H](C)N)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2/c1-3-4-7(8(9,10)11)13-5-6(2)12/h4-6H,3,12H2,1-2H3/b7-4-,13-5+/t6-/m1/s1 |
| InChIKey | RKYACCVVYYQFRA-YLZTWHQMSA-N |
| XLogP | 2.26 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine?
The IUPAC name of (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine (CID 163933764) is (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine.
What is the SMILES notation for (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine?
The canonical SMILES for (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine is CC/C=C(\N=C\[C@@H](C)N)C(F)(F)F.
What is the InChIKey of (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine?
The InChIKey is RKYACCVVYYQFRA-YLZTWHQMSA-N. The full InChI is InChI=1S/C8H13F3N2/c1-3-4-7(8(9,10)11)13-5-6(2)12/h4-6H,3,12H2,1-2H3/b7-4-,13-5+/t6-/m1/s1.
What are the key properties of (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine?
(2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine has a molecular weight of 194.20 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminopropan-2-amine is sourced from PubChem (CID 163933764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).