C23H26B2FN9O7P2 — CID 163934580
CID 163934580 (PubChem CID 163934580) has the molecular formula C23H26B2FN9O7P2 and a molecular weight of 643.09 g/mol.
| Compound Name | CID 163934580 |
|---|---|
| PubChem CID | 163934580 |
| Molecular Formula | C23H26B2FN9O7P2 |
| Molecular Weight | 643.09 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)CC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2OP([B])(=O)CC[C@H]2O[C@@H](n3cnc4c(N)ccnc43)[C@@H](O)C2O1 |
| InChI | InChI=1S/C23H26B2FN9O7P2/c24-43(37)6-3-12-18(16(36)23(40-12)35-8-32-14-10(27)1-4-29-20(14)35)42-44(25,38)5-2-11-17(41-43)13(26)22(39-11)34-9-33-15-19(28)30-7-31-21(15)34/h1,4,7-9,11-13,16-18,22-23,36H,2-3,5-6H2,(H2,27,29)(H2,28,30,31)/t11-,12-,13?,16+,17+,18?,22-,23-,43?,44?/m1/s1 |
| InChIKey | CBOKZIKBEOLKSN-CYJGTXHPSA-N |
| XLogP | 1.22 |
| TPSA | 217.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.09 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|