C17H16Cl2O3 — CID 163934815
methyl (2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]propanoate (PubChem CID 163934815) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is methyl (2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 163934815 |
| Molecular Formula | C17H16Cl2O3 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | methyl (2S)-2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](C)c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16Cl2O3/c1-11(17(20)21-2)13-4-6-14(7-5-13)22-10-12-3-8-15(18)16(19)9-12/h3-9,11H,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | RLUDENGDNUTEDS-NSHDSACASA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |