C28H33ClN4O7S — CID 163935025
tert-butyl (2S)-4-(3-chloroisoquinolin-1-yl)oxy-2-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 163935025) has the molecular formula C28H33ClN4O7S and a molecular weight of 605.11 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3-chloroisoquinolin-1-yl)oxy-2-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(3-chloroisoquinolin-1-yl)oxy-2-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163935025 |
| Molecular Formula | C28H33ClN4O7S |
| Molecular Weight | 605.11 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | tert-butyl (2S)-4-(3-chloroisoquinolin-1-yl)oxy-2-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CC(Oc2nc(Cl)cc3ccccc23)CN1C(=O)OC(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C28H33ClN4O7S/c1-5-17-14-28(17,25(35)32-41(37,38)19-10-11-19)31-23(34)21-13-18(15-33(21)26(36)40-27(2,3)4)39-24-20-9-7-6-8-16(20)12-22(29)30-24/h5-9,12,17-19,21H,1,10-11,13-15H2,2-4H3,(H,31,34)(H,32,35)/t17-,18?,21+,28-/m1/s1 |
| InChIKey | RLYYTIUVYCDHNP-KVIKXTEFSA-N |
| XLogP | 3.31 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|