C12H20N4S — CID 163935619
5-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-2-thione (PubChem CID 163935619) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-2-thione.
| Compound Name | 5-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 163935619 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-2-thione |
| SMILES | CN1CCc2c([nH]c(=S)n2C2CCNCC2)C1 |
| InChI | InChI=1S/C12H20N4S/c1-15-7-4-11-10(8-15)14-12(17)16(11)9-2-5-13-6-3-9/h9,13H,2-8H2,1H3,(H,14,17) |
| InChIKey | RMNYJFDHKKUSCI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|