C24H30 — CID 163936414
(1Z,3Z,5Z,7Z,11Z,13Z,15Z)-8-(4-methylcyclohexyl)cycloheptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 163936414) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z,11Z,13Z,15Z)-8-(4-methylcyclohexyl)cycloheptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,3Z,5Z,7Z,11Z,13Z,15Z)-8-(4-methylcyclohexyl)cycloheptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 163936414 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (1Z,3Z,5Z,7Z,11Z,13Z,15Z)-8-(4-methylcyclohexyl)cycloheptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | CC1CCC(/C2=C/C=C\C=C/C=C\C/C=C\C=C/C=C\C=C2)CC1 |
| InChI | InChI=1S/C24H30/c1-22-18-20-24(21-19-22)23-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-23/h2,4-17,22,24H,3,18-21H2,1H3/b4-2-,7-5-,8-6-,11-9-,12-10-,15-13-,16-14?,23-17+ |
| InChIKey | RNFBTEPIVXKEJY-PJAOLATQSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |