C28H31Br3N- — CID 163936419
2-benzyl-7-bromo-1-methyl-1,2,3,4-tetrahydronaphthalene;7-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline;bromide (PubChem CID 163936419) has the molecular formula C28H31Br3N- and a molecular weight of 621.28 g/mol. Its IUPAC name is 2-benzyl-7-bromo-1-methyl-1,2,3,4-tetrahydronaphthalene;7-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline;bromide.
| Compound Name | 2-benzyl-7-bromo-1-methyl-1,2,3,4-tetrahydronaphthalene;7-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline;bromide |
|---|---|
| PubChem CID | 163936419 |
| Molecular Formula | C28H31Br3N- |
| Molecular Weight | 621.28 g/mol |
| Exact Mass | 618.00 |
| IUPAC Name | 2-benzyl-7-bromo-1-methyl-1,2,3,4-tetrahydronaphthalene;7-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline;bromide |
| SMILES | CC1NCCc2ccc(Br)cc21.CC1c2cc(Br)ccc2CCC1Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C18H19Br.C10H12BrN.BrH/c1-13-16(11-14-5-3-2-4-6-14)8-7-15-9-10-17(19)12-18(13)15;1-7-10-6-9(11)3-2-8(10)4-5-12-7;/h2-6,9-10,12-13,16H,7-8,11H2,1H3;2-3,6-7,12H,4-5H2,1H3;1H/p-1 |
| InChIKey | BKFLVWBILJLLOE-UHFFFAOYSA-M |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |