C19H21ClF5N3O2 — CID 163937763
(4S)-4-[3-(3-chloro-2,4-difluorophenyl)-3-[1-(2,2,2-trifluoroethyl)piperidin-2-yl]propanoyl]imidazolidin-2-one (PubChem CID 163937763) has the molecular formula C19H21ClF5N3O2 and a molecular weight of 453.84 g/mol. Its IUPAC name is (4S)-4-[3-(3-chloro-2,4-difluorophenyl)-3-[1-(2,2,2-trifluoroethyl)piperidin-2-yl]propanoyl]imidazolidin-2-one.
| Compound Name | (4S)-4-[3-(3-chloro-2,4-difluorophenyl)-3-[1-(2,2,2-trifluoroethyl)piperidin-2-yl]propanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 163937763 |
| Molecular Formula | C19H21ClF5N3O2 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (4S)-4-[3-(3-chloro-2,4-difluorophenyl)-3-[1-(2,2,2-trifluoroethyl)piperidin-2-yl]propanoyl]imidazolidin-2-one |
| SMILES | O=C1NC[C@@H](C(=O)CC(c2ccc(F)c(Cl)c2F)C2CCCCN2CC(F)(F)F)N1 |
| InChI | InChI=1S/C19H21ClF5N3O2/c20-16-12(21)5-4-10(17(16)22)11(7-15(29)13-8-26-18(30)27-13)14-3-1-2-6-28(14)9-19(23,24)25/h4-5,11,13-14H,1-3,6-9H2,(H2,26,27,30)/t11?,13-,14?/m0/s1 |
| InChIKey | ROGUZYUOCVRDFJ-QRMWWUJWSA-N |
| XLogP | 3.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|