About (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene
(8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene (PubChem CID 163938019) has the molecular formula C15H16Cl2
and a molecular weight of 267.20 g/mol. Its IUPAC name is (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene.
Molecular Properties
| Compound Name | (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene |
| PubChem CID | 163938019 |
| Molecular Formula | C15H16Cl2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene |
| SMILES | C[C@H]1C2CC=C(c3ccc(Cl)c(Cl)c3)CCC21 |
| InChI | InChI=1S/C15H16Cl2/c1-9-12-5-2-10(3-6-13(9)12)11-4-7-14(16)15(17)8-11/h2,4,7-9,12-13H,3,5-6H2,1H3/t9-,12?,13?/m0/s1 |
| InChIKey | ROMOTOMAFSCOMH-ALXWSUNGSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene?
The IUPAC name of (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene (CID 163938019) is (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene.
What is the SMILES notation for (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene?
The canonical SMILES for (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene is C[C@H]1C2CC=C(c3ccc(Cl)c(Cl)c3)CCC21.
What is the InChIKey of (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene?
The InChIKey is ROMOTOMAFSCOMH-ALXWSUNGSA-N. The full InChI is InChI=1S/C15H16Cl2/c1-9-12-5-2-10(3-6-13(9)12)11-4-7-14(16)15(17)8-11/h2,4,7-9,12-13H,3,5-6H2,1H3/t9-,12?,13?/m0/s1.
What are the key properties of (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene?
(8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene has a molecular weight of 267.20 g/mol, XLogP of 5.44, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-4-(3,4-dichlorophenyl)-8-methylbicyclo[5.1.0]oct-3-ene is sourced from PubChem (CID 163938019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).