About 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole
4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole (PubChem CID 163938167) has the molecular formula C12H6F2N4
and a molecular weight of 244.20 g/mol. Its IUPAC name is 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole.
Molecular Properties
| Compound Name | 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole |
| PubChem CID | 163938167 |
| Molecular Formula | C12H6F2N4 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole |
| SMILES | Fc1cc2c(c3c(F)cc4c(c13)=NCN=4)=NCN=2 |
| InChI | InChI=1S/C12H6F2N4/c13-5-1-7-11(17-3-15-7)10-6(14)2-8-12(9(5)10)18-4-16-8/h1-2H,3-4H2 |
| InChIKey | ROPXSVHNYQKBQO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
The IUPAC name of 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole (CID 163938167) is 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole.
What is the SMILES notation for 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
The canonical SMILES for 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole is Fc1cc2c(c3c(F)cc4c(c13)=NCN=4)=NCN=2.
What is the InChIKey of 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
The InChIKey is ROPXSVHNYQKBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F2N4/c13-5-1-7-11(17-3-15-7)10-6(14)2-8-12(9(5)10)18-4-16-8/h1-2H,3-4H2.
What are the key properties of 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole?
4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole has a molecular weight of 244.20 g/mol, XLogP of -0.46, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-difluoro-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole is sourced from PubChem (CID 163938167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).