C56H44N4O — CID 163938502
N-(1-dibenzofuran-4-ylethylidene)-5-[5-ethyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-N'-[(Z)-1-phenylprop-1-enyl]-9H-fluorene-1-carboximidamide (PubChem CID 163938502) has the molecular formula C56H44N4O and a molecular weight of 789.00 g/mol. Its IUPAC name is N-(1-dibenzofuran-4-ylethylidene)-5-[5-ethyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-N'-[(Z)-1-phenylprop-1-enyl]-9H-fluorene-1-carboximidamide.
| Compound Name | N-(1-dibenzofuran-4-ylethylidene)-5-[5-ethyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-N'-[(Z)-1-phenylprop-1-enyl]-9H-fluorene-1-carboximidamide |
|---|---|
| PubChem CID | 163938502 |
| Molecular Formula | C56H44N4O |
| Molecular Weight | 789.00 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | N-(1-dibenzofuran-4-ylethylidene)-5-[5-ethyl-4-(2-methylphenyl)-6-phenylpyrimidin-2-yl]-N'-[(Z)-1-phenylprop-1-enyl]-9H-fluorene-1-carboximidamide |
| SMILES | C/C=C(\N=C(/N=C(\C)c1cccc2c1oc1ccccc12)c1cccc2c1Cc1cccc(-c3nc(-c4ccccc4)c(CC)c(-c4ccccc4C)n3)c1-2)c1ccccc1 |
| InChI | InChI=1S/C56H44N4O/c1-5-40-52(38-23-11-8-12-24-38)59-56(60-53(40)41-26-14-13-20-35(41)3)47-32-17-25-39-34-48-44(51(39)47)29-19-31-46(48)55(58-49(6-2)37-21-9-7-10-22-37)57-36(4)42-28-18-30-45-43-27-15-16-33-50(43)61-54(42)45/h6-33H,5,34H2,1-4H3/b49-6-,57-36+,58-55- |
| InChIKey | ROXWUUKBABEDOH-DSRNGEQCSA-N |
| XLogP | 14.14 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.00 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|