About (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine
(2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine (PubChem CID 163939113) has the molecular formula C9H17F2N
and a molecular weight of 177.24 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine |
| PubChem CID | 163939113 |
| Molecular Formula | C9H17F2N |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine |
| SMILES | CC(C)CN1CC(F)(F)C[C@H]1C |
| InChI | InChI=1S/C9H17F2N/c1-7(2)5-12-6-9(10,11)4-8(12)3/h7-8H,4-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | RPKVCXLSVVWNKF-MRVPVSSYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine?
The IUPAC name of (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine (CID 163939113) is (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine.
What is the SMILES notation for (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine?
The canonical SMILES for (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine is CC(C)CN1CC(F)(F)C[C@H]1C.
What is the InChIKey of (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine?
The InChIKey is RPKVCXLSVVWNKF-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H17F2N/c1-7(2)5-12-6-9(10,11)4-8(12)3/h7-8H,4-6H2,1-3H3/t8-/m1/s1.
What are the key properties of (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine?
(2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine has a molecular weight of 177.24 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-difluoro-2-methyl-1-(2-methylpropyl)pyrrolidine is sourced from PubChem (CID 163939113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).