C32H29FN3O4S+ — CID 163939493
6-[4-[(3R)-3-[(4-fluorophenyl)methoxy]pyrrolidin-1-yl]phenyl]-1-methyl-1-(2-methyl-1,3-benzothiazol-6-yl)-4-oxopyridin-1-ium-3-carboxylic acid (PubChem CID 163939493) has the molecular formula C32H29FN3O4S+ and a molecular weight of 570.67 g/mol. Its IUPAC name is 6-[4-[(3R)-3-[(4-fluorophenyl)methoxy]pyrrolidin-1-yl]phenyl]-1-methyl-1-(2-methyl-1,3-benzothiazol-6-yl)-4-oxopyridin-1-ium-3-carboxylic acid.
| Compound Name | 6-[4-[(3R)-3-[(4-fluorophenyl)methoxy]pyrrolidin-1-yl]phenyl]-1-methyl-1-(2-methyl-1,3-benzothiazol-6-yl)-4-oxopyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 163939493 |
| Molecular Formula | C32H29FN3O4S+ |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 6-[4-[(3R)-3-[(4-fluorophenyl)methoxy]pyrrolidin-1-yl]phenyl]-1-methyl-1-(2-methyl-1,3-benzothiazol-6-yl)-4-oxopyridin-1-ium-3-carboxylic acid |
| SMILES | Cc1nc2ccc([N+]3(C)C=C(C(=O)O)C(=O)C=C3c3ccc(N4CC[C@@H](OCc5ccc(F)cc5)C4)cc3)cc2s1 |
| InChI | InChI=1S/C32H28FN3O4S/c1-20-34-28-12-11-25(15-31(28)41-20)36(2)18-27(32(38)39)30(37)16-29(36)22-5-9-24(10-6-22)35-14-13-26(17-35)40-19-21-3-7-23(33)8-4-21/h3-12,15-16,18,26H,13-14,17,19H2,1-2H3/p+1/t26-,36?/m1/s1 |
| InChIKey | FOTFXMRWQVPOMV-IERCKHOLSA-O |
| XLogP | 6.07 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|