About 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile
2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile (PubChem CID 163939730) has the molecular formula C8H8INO2S
and a molecular weight of 309.13 g/mol. Its IUPAC name is 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile.
Molecular Properties
| Compound Name | 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile |
| PubChem CID | 163939730 |
| Molecular Formula | C8H8INO2S |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile |
| SMILES | CCS(=O)(=O)C1=IC=CC(C#N)=C1 |
| InChI | InChI=1S/C8H8INO2S/c1-2-13(11,12)8-5-7(6-10)3-4-9-8/h3-5H,2H2,1H3 |
| InChIKey | RPYQYCUCKMNKIG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile?
The IUPAC name of 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile (CID 163939730) is 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile.
What is the SMILES notation for 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile?
The canonical SMILES for 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile is CCS(=O)(=O)C1=IC=CC(C#N)=C1.
What is the InChIKey of 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile?
The InChIKey is RPYQYCUCKMNKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO2S/c1-2-13(11,12)8-5-7(6-10)3-4-9-8/h3-5H,2H2,1H3.
What are the key properties of 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile?
2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile has a molecular weight of 309.13 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonyl-1λ3-iodacyclohexa-1,3,5-triene-4-carbonitrile is sourced from PubChem (CID 163939730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).