C7H8FIN2 — CID 163940039
6-fluoro-3-iodo-1,2,3,8a-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 163940039) has the molecular formula C7H8FIN2 and a molecular weight of 266.06 g/mol. Its IUPAC name is 6-fluoro-3-iodo-1,2,3,8a-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 6-fluoro-3-iodo-1,2,3,8a-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 163940039 |
| Molecular Formula | C7H8FIN2 |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 6-fluoro-3-iodo-1,2,3,8a-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | FC1=CN2C(I)CNC2C=C1 |
| InChI | InChI=1S/C7H8FIN2/c8-5-1-2-7-10-3-6(9)11(7)4-5/h1-2,4,6-7,10H,3H2 |
| InChIKey | RQFAMRWELZMLAK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|