About (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine
(2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine (PubChem CID 163940071) has the molecular formula C14H28ClN
and a molecular weight of 245.84 g/mol. Its IUPAC name is (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine.
Molecular Properties
| Compound Name | (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine |
| PubChem CID | 163940071 |
| Molecular Formula | C14H28ClN |
| Molecular Weight | 245.84 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine |
| SMILES | CCC(C)C[C@H]([C@H](C)Cl)N1CCCC[C@@H]1C |
| InChI | InChI=1S/C14H28ClN/c1-5-11(2)10-14(13(4)15)16-9-7-6-8-12(16)3/h11-14H,5-10H2,1-4H3/t11?,12-,13-,14+/m0/s1 |
| InChIKey | RQFXWVAHNMCSBC-PBNFFQIGSA-N |
| XLogP | 4.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine?
The IUPAC name of (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine (CID 163940071) is (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine.
What is the SMILES notation for (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine?
The canonical SMILES for (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine is CCC(C)C[C@H]([C@H](C)Cl)N1CCCC[C@@H]1C.
What is the InChIKey of (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine?
The InChIKey is RQFXWVAHNMCSBC-PBNFFQIGSA-N. The full InChI is InChI=1S/C14H28ClN/c1-5-11(2)10-14(13(4)15)16-9-7-6-8-12(16)3/h11-14H,5-10H2,1-4H3/t11?,12-,13-,14+/m0/s1.
What are the key properties of (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine?
(2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine has a molecular weight of 245.84 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2S,3R)-2-chloro-5-methylheptan-3-yl]-2-methylpiperidine is sourced from PubChem (CID 163940071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).