C22H35NO3 — CID 163940322
methyl (1R,4aS,4bS,6S,7S,8R,8aS,10aS)-7-(cyanomethyl)-8-hydroxy-1,4a,6,8a-tetramethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 163940322) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is methyl (1R,4aS,4bS,6S,7S,8R,8aS,10aS)-7-(cyanomethyl)-8-hydroxy-1,4a,6,8a-tetramethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,4bS,6S,7S,8R,8aS,10aS)-7-(cyanomethyl)-8-hydroxy-1,4a,6,8a-tetramethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 163940322 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | methyl (1R,4aS,4bS,6S,7S,8R,8aS,10aS)-7-(cyanomethyl)-8-hydroxy-1,4a,6,8a-tetramethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3C[C@H](C)[C@H](CC#N)[C@@H](O)[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C22H35NO3/c1-14-13-17-20(2)9-6-10-22(4,19(25)26-5)16(20)7-11-21(17,3)18(24)15(14)8-12-23/h14-18,24H,6-11,13H2,1-5H3/t14-,15-,16-,17-,18+,20+,21-,22+/m0/s1 |
| InChIKey | RQKYBMMLMOXVMV-MLCDXTPOSA-N |
| XLogP | 4.32 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |