C14H19NO4 — CID 163940692
methyl (2E,4Z,6Z)-2-[(E)-1-nitrobut-1-enyl]nona-2,4,6-trienoate (PubChem CID 163940692) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (2E,4Z,6Z)-2-[(E)-1-nitrobut-1-enyl]nona-2,4,6-trienoate.
| Compound Name | methyl (2E,4Z,6Z)-2-[(E)-1-nitrobut-1-enyl]nona-2,4,6-trienoate |
|---|---|
| PubChem CID | 163940692 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl (2E,4Z,6Z)-2-[(E)-1-nitrobut-1-enyl]nona-2,4,6-trienoate |
| SMILES | CC/C=C\C=C/C=C(C(=O)OC)\C(=C/CC)[N+](=O)[O-] |
| InChI | InChI=1S/C14H19NO4/c1-4-6-7-8-9-11-12(14(16)19-3)13(10-5-2)15(17)18/h6-11H,4-5H2,1-3H3/b7-6-,9-8-,12-11+,13-10+ |
| InChIKey | RQSFVZUECSGQMR-STDJXMHSSA-N |
| XLogP | 3.18 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|