C14H25N4+ — CID 163940882
3,5-diethyl-4-[(1-methylimidazolidin-3-ium-2-ylidene)amino]cyclohexa-1,5-dien-1-amine (PubChem CID 163940882) has the molecular formula C14H25N4+ and a molecular weight of 249.38 g/mol. Its IUPAC name is 3,5-diethyl-4-[(1-methylimidazolidin-3-ium-2-ylidene)amino]cyclohexa-1,5-dien-1-amine.
| Compound Name | 3,5-diethyl-4-[(1-methylimidazolidin-3-ium-2-ylidene)amino]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 163940882 |
| Molecular Formula | C14H25N4+ |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3,5-diethyl-4-[(1-methylimidazolidin-3-ium-2-ylidene)amino]cyclohexa-1,5-dien-1-amine |
| SMILES | CCC1=CC(N)=CC(CC)C1/N=C1\[NH2+]CCN1C |
| InChI | InChI=1S/C14H24N4/c1-4-10-8-12(15)9-11(5-2)13(10)17-14-16-6-7-18(14)3/h8-10,13H,4-7,15H2,1-3H3,(H,16,17)/p+1 |
| InChIKey | RQWBLIQFENBXKR-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 58.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|