C7H6N3O+ — CID 163941173
8,10-diaza-4-azoniabicyclo[5.3.0]deca-1,3,4,6-tetraen-9-one (PubChem CID 163941173) has the molecular formula C7H6N3O+ and a molecular weight of 148.14 g/mol. Its IUPAC name is 8,10-diaza-4-azoniabicyclo[5.3.0]deca-1,3,4,6-tetraen-9-one.
| Compound Name | 8,10-diaza-4-azoniabicyclo[5.3.0]deca-1,3,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 163941173 |
| Molecular Formula | C7H6N3O+ |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 8,10-diaza-4-azoniabicyclo[5.3.0]deca-1,3,4,6-tetraen-9-one |
| SMILES | O=c1[nH]c2c([nH]1)=CC=[N+]=CC=2 |
| InChI | InChI=1S/C7H5N3O/c11-7-9-5-1-3-8-4-2-6(5)10-7/h1-4H,(H,8,9,10,11)/p+1 |
| InChIKey | HXTOOGBKTUZXMW-UHFFFAOYSA-O |
| XLogP | -2.51 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|